C7H13N4Y- — CID 59878530
3-(2-aminoethyl)-2,5-dihydropyrrole-1-carboximidamide;yttrium (PubChem CID 59878530) has the molecular formula C7H13N4Y- and a molecular weight of 242.11 g/mol. Its IUPAC name is 3-(2-aminoethyl)-2,5-dihydropyrrole-1-carboximidamide;yttrium.
| Compound Name | 3-(2-aminoethyl)-2,5-dihydropyrrole-1-carboximidamide;yttrium |
|---|---|
| PubChem CID | 59878530 |
| Molecular Formula | C7H13N4Y- |
| Molecular Weight | 242.11 g/mol |
| Exact Mass | 242.02 |
| IUPAC Name | 3-(2-aminoethyl)-2,5-dihydropyrrole-1-carboximidamide;yttrium |
| SMILES | [H]/N=C(\N)N1CC=C(C[CH-]N)C1.[Y] |
| InChI | InChI=1S/C7H13N4.Y/c8-3-1-6-2-4-11(5-6)7(9)10;/h2-3H,1,4-5,8H2,(H3,9,10);/q-1; |
| InChIKey | RLEUVGBAYIVRFE-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 79.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.11 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|