C7H13N3 — CID 143657702
4-methyl-3,6-dihydro-2H-pyridine-1-carboximidamide (PubChem CID 143657702) has the molecular formula C7H13N3 and a molecular weight of 139.20 g/mol. Its IUPAC name is 4-methyl-3,6-dihydro-2H-pyridine-1-carboximidamide.
| Compound Name | 4-methyl-3,6-dihydro-2H-pyridine-1-carboximidamide |
|---|---|
| PubChem CID | 143657702 |
| Molecular Formula | C7H13N3 |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.11 |
| IUPAC Name | 4-methyl-3,6-dihydro-2H-pyridine-1-carboximidamide |
| SMILES | [H]/N=C(\N)N1CC=C(C)CC1 |
| InChI | InChI=1S/C7H13N3/c1-6-2-4-10(5-3-6)7(8)9/h2H,3-5H2,1H3,(H3,8,9) |
| InChIKey | ZMMOAIUBIKRSNG-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|