C8H15N3 — CID 142256094
2-(1-methanimidoyl-2,5-dihydropyrrol-3-yl)-N-methylethanamine (PubChem CID 142256094) has the molecular formula C8H15N3 and a molecular weight of 153.23 g/mol. Its IUPAC name is 2-(1-methanimidoyl-2,5-dihydropyrrol-3-yl)-N-methylethanamine.
| Compound Name | 2-(1-methanimidoyl-2,5-dihydropyrrol-3-yl)-N-methylethanamine |
|---|---|
| PubChem CID | 142256094 |
| Molecular Formula | C8H15N3 |
| Molecular Weight | 153.23 g/mol |
| Exact Mass | 153.13 |
| IUPAC Name | 2-(1-methanimidoyl-2,5-dihydropyrrol-3-yl)-N-methylethanamine |
| SMILES | [H]/N=C/N1CC=C(CCNC)C1 |
| InChI | InChI=1S/C8H15N3/c1-10-4-2-8-3-5-11(6-8)7-9/h3,7,9-10H,2,4-6H2,1H3/b9-7+ |
| InChIKey | BMOSKOAUWPLHOF-VQHVLOKHSA-N |
| XLogP | 0.44 |
| TPSA | 39.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.23 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|