C7H15Cl2N5 — CID 142722439
N-(diaminomethylidene)-3,6-dihydro-2H-pyridine-1-carboximidamide;dihydrochloride (PubChem CID 142722439) has the molecular formula C7H15Cl2N5 and a molecular weight of 240.14 g/mol. Its IUPAC name is N-(diaminomethylidene)-3,6-dihydro-2H-pyridine-1-carboximidamide;dihydrochloride.
| Compound Name | N-(diaminomethylidene)-3,6-dihydro-2H-pyridine-1-carboximidamide;dihydrochloride |
|---|---|
| PubChem CID | 142722439 |
| Molecular Formula | C7H15Cl2N5 |
| Molecular Weight | 240.14 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | N-(diaminomethylidene)-3,6-dihydro-2H-pyridine-1-carboximidamide;dihydrochloride |
| SMILES | Cl.Cl.[H]/N=C(\N=C(N)N)N1CC=CCC1 |
| InChI | InChI=1S/C7H13N5.2ClH/c8-6(9)11-7(10)12-4-2-1-3-5-12;;/h1-2H,3-5H2,(H5,8,9,10,11);2*1H |
| InChIKey | VTRNMLAAAQGVJS-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.14 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|