C11H22ClN5 — CID 176518278
N-(N'-butylcarbamimidoyl)-3,6-dihydro-2H-pyridine-1-carboximidamide;hydrochloride (PubChem CID 176518278) has the molecular formula C11H22ClN5 and a molecular weight of 259.78 g/mol. Its IUPAC name is N-(N'-butylcarbamimidoyl)-3,6-dihydro-2H-pyridine-1-carboximidamide;hydrochloride.
| Compound Name | N-(N'-butylcarbamimidoyl)-3,6-dihydro-2H-pyridine-1-carboximidamide;hydrochloride |
|---|---|
| PubChem CID | 176518278 |
| Molecular Formula | C11H22ClN5 |
| Molecular Weight | 259.78 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | N-(N'-butylcarbamimidoyl)-3,6-dihydro-2H-pyridine-1-carboximidamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N/C(N)=N/CCCC)N1CC=CCC1 |
| InChI | InChI=1S/C11H21N5.ClH/c1-2-3-7-14-10(12)15-11(13)16-8-5-4-6-9-16;/h4-5H,2-3,6-9H2,1H3,(H4,12,13,14,15);1H |
| InChIKey | ABWFDCBNABTABI-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 77.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.78 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|