C12H20ClN5 — CID 161070241
N'-(3,6-dihydro-2H-pyridine-1-carboximidoyl)-3,6-dihydro-2H-pyridine-1-carboximidamide;hydrochloride (PubChem CID 161070241) has the molecular formula C12H20ClN5 and a molecular weight of 269.78 g/mol. Its IUPAC name is N'-(3,6-dihydro-2H-pyridine-1-carboximidoyl)-3,6-dihydro-2H-pyridine-1-carboximidamide;hydrochloride.
| Compound Name | N'-(3,6-dihydro-2H-pyridine-1-carboximidoyl)-3,6-dihydro-2H-pyridine-1-carboximidamide;hydrochloride |
|---|---|
| PubChem CID | 161070241 |
| Molecular Formula | C12H20ClN5 |
| Molecular Weight | 269.78 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | N'-(3,6-dihydro-2H-pyridine-1-carboximidoyl)-3,6-dihydro-2H-pyridine-1-carboximidamide;hydrochloride |
| SMILES | Cl.[H]/N=C(/N=C(N)N1CC=CCC1)N1CC=CCC1 |
| InChI | InChI=1S/C12H19N5.ClH/c13-11(16-7-3-1-4-8-16)15-12(14)17-9-5-2-6-10-17;/h1-3,5H,4,6-10H2,(H3,13,14,15);1H |
| InChIKey | SNQSGMZPEIPFQN-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 68.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.78 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|