C7H14ClN5 — CID 121267941
N-(diaminomethylidene)-3,6-dihydro-2H-pyridine-1-carboximidamide;hydrochloride (PubChem CID 121267941) has the molecular formula C7H14ClN5 and a molecular weight of 203.68 g/mol. Its IUPAC name is N-(diaminomethylidene)-3,6-dihydro-2H-pyridine-1-carboximidamide;hydrochloride.
| Compound Name | N-(diaminomethylidene)-3,6-dihydro-2H-pyridine-1-carboximidamide;hydrochloride |
|---|---|
| PubChem CID | 121267941 |
| Molecular Formula | C7H14ClN5 |
| Molecular Weight | 203.68 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | N-(diaminomethylidene)-3,6-dihydro-2H-pyridine-1-carboximidamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N=C(N)N)N1CC=CCC1 |
| InChI | InChI=1S/C7H13N5.ClH/c8-6(9)11-7(10)12-4-2-1-3-5-12;/h1-2H,3-5H2,(H5,8,9,10,11);1H |
| InChIKey | QCTGSTVFQOAIGZ-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.68 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|