C14H30N10 — CID 159035908
3-(diaminomethylidene)-1-[(Z)-8-[[N-(diaminomethylidene)carbamimidoyl]-methylamino]oct-4-enyl]-1-methylguanidine (PubChem CID 159035908) has the molecular formula C14H30N10 and a molecular weight of 338.46 g/mol. Its IUPAC name is 3-(diaminomethylidene)-1-[(Z)-8-[[N-(diaminomethylidene)carbamimidoyl]-methylamino]oct-4-enyl]-1-methylguanidine.
| Compound Name | 3-(diaminomethylidene)-1-[(Z)-8-[[N-(diaminomethylidene)carbamimidoyl]-methylamino]oct-4-enyl]-1-methylguanidine |
|---|---|
| PubChem CID | 159035908 |
| Molecular Formula | C14H30N10 |
| Molecular Weight | 338.46 g/mol |
| Exact Mass | 338.27 |
| IUPAC Name | 3-(diaminomethylidene)-1-[(Z)-8-[[N-(diaminomethylidene)carbamimidoyl]-methylamino]oct-4-enyl]-1-methylguanidine |
| SMILES | [H]/N=C(/N=C(N)N)N(C)CCC/C=C\CCCN(C)/C(N=C(N)N)=N\[H] |
| InChI | InChI=1S/C14H30N10/c1-23(13(19)21-11(15)16)9-7-5-3-4-6-8-10-24(2)14(20)22-12(17)18/h3-4H,5-10H2,1-2H3,(H5,15,16,19,21)(H5,17,18,20,22)/b4-3- |
| InChIKey | JVLMPLLIHDXVQH-ARJAWSKDSA-N |
| XLogP | -0.62 |
| TPSA | 182.98 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.46 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|