C6H10N2 — CID 56616795
1-methyl-2,5-dihydropyridin-6-imine (PubChem CID 56616795) has the molecular formula C6H10N2 and a molecular weight of 110.16 g/mol. Its IUPAC name is 1-methyl-2,5-dihydropyridin-6-imine.
| Compound Name | 1-methyl-2,5-dihydropyridin-6-imine |
|---|---|
| PubChem CID | 56616795 |
| Molecular Formula | C6H10N2 |
| Molecular Weight | 110.16 g/mol |
| Exact Mass | 110.08 |
| IUPAC Name | 1-methyl-2,5-dihydropyridin-6-imine |
| SMILES | [H]/N=C1\CC=CCN1C |
| InChI | InChI=1S/C6H10N2/c1-8-5-3-2-4-6(8)7/h2-3,7H,4-5H2,1H3/b7-6+ |
| InChIKey | UUAIXYDSSDNGAQ-VOTSOKGWSA-N |
| XLogP | 0.86 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 110.16 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|