About 6-imino-2,5-dihydropyridin-1-amine
6-imino-2,5-dihydropyridin-1-amine (PubChem CID 57319571) has the molecular formula C5H9N3
and a molecular weight of 111.15 g/mol. Its IUPAC name is 6-imino-2,5-dihydropyridin-1-amine.
Molecular Properties
| Compound Name | 6-imino-2,5-dihydropyridin-1-amine |
| PubChem CID | 57319571 |
| Molecular Formula | C5H9N3 |
| Molecular Weight | 111.15 g/mol |
| Exact Mass | 111.08 |
| IUPAC Name | 6-imino-2,5-dihydropyridin-1-amine |
| SMILES | [H]/N=C1\CC=CCN1N |
| InChI | InChI=1S/C5H9N3/c6-5-3-1-2-4-8(5)7/h1-2,6H,3-4,7H2/b6-5+ |
| InChIKey | FFHZTXXXXKUSOA-AATRIKPKSA-N |
| XLogP | 0.10 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 111.15 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-imino-2,5-dihydropyridin-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-imino-2,5-dihydropyridin-1-amine?
The IUPAC name of 6-imino-2,5-dihydropyridin-1-amine (CID 57319571) is 6-imino-2,5-dihydropyridin-1-amine.
What is the SMILES notation for 6-imino-2,5-dihydropyridin-1-amine?
The canonical SMILES for 6-imino-2,5-dihydropyridin-1-amine is [H]/N=C1\CC=CCN1N.
What is the InChIKey of 6-imino-2,5-dihydropyridin-1-amine?
The InChIKey is FFHZTXXXXKUSOA-AATRIKPKSA-N. The full InChI is InChI=1S/C5H9N3/c6-5-3-1-2-4-8(5)7/h1-2,6H,3-4,7H2/b6-5+.
What are the key properties of 6-imino-2,5-dihydropyridin-1-amine?
6-imino-2,5-dihydropyridin-1-amine has a molecular weight of 111.15 g/mol, XLogP of 0.10, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-imino-2,5-dihydropyridin-1-amine is sourced from PubChem (CID 57319571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).