About 1-chloro-2,5-dihydropyridin-6-imine
1-chloro-2,5-dihydropyridin-6-imine (PubChem CID 91526954) has the molecular formula C5H7ClN2
and a molecular weight of 130.58 g/mol. Its IUPAC name is 1-chloro-2,5-dihydropyridin-6-imine.
Molecular Properties
| Compound Name | 1-chloro-2,5-dihydropyridin-6-imine |
| PubChem CID | 91526954 |
| Molecular Formula | C5H7ClN2 |
| Molecular Weight | 130.58 g/mol |
| Exact Mass | 130.03 |
| IUPAC Name | 1-chloro-2,5-dihydropyridin-6-imine |
| SMILES | [H]/N=C1\CC=CCN1Cl |
| InChI | InChI=1S/C5H7ClN2/c6-8-4-2-1-3-5(8)7/h1-2,7H,3-4H2/b7-5+ |
| InChIKey | DMTFNZGXISWVNI-FNORWQNLSA-N |
| XLogP | 1.38 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.58 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-2,5-dihydropyridin-6-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-2,5-dihydropyridin-6-imine?
The IUPAC name of 1-chloro-2,5-dihydropyridin-6-imine (CID 91526954) is 1-chloro-2,5-dihydropyridin-6-imine.
What is the SMILES notation for 1-chloro-2,5-dihydropyridin-6-imine?
The canonical SMILES for 1-chloro-2,5-dihydropyridin-6-imine is [H]/N=C1\CC=CCN1Cl.
What is the InChIKey of 1-chloro-2,5-dihydropyridin-6-imine?
The InChIKey is DMTFNZGXISWVNI-FNORWQNLSA-N. The full InChI is InChI=1S/C5H7ClN2/c6-8-4-2-1-3-5(8)7/h1-2,7H,3-4H2/b7-5+.
What are the key properties of 1-chloro-2,5-dihydropyridin-6-imine?
1-chloro-2,5-dihydropyridin-6-imine has a molecular weight of 130.58 g/mol, XLogP of 1.38, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-2,5-dihydropyridin-6-imine is sourced from PubChem (CID 91526954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).