About N-methyl-6-methylimino-2,5-dihydropyridin-1-amine
N-methyl-6-methylimino-2,5-dihydropyridin-1-amine (PubChem CID 57320112) has the molecular formula C7H13N3
and a molecular weight of 139.20 g/mol. Its IUPAC name is N-methyl-6-methylimino-2,5-dihydropyridin-1-amine.
Molecular Properties
| Compound Name | N-methyl-6-methylimino-2,5-dihydropyridin-1-amine |
| PubChem CID | 57320112 |
| Molecular Formula | C7H13N3 |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.11 |
| IUPAC Name | N-methyl-6-methylimino-2,5-dihydropyridin-1-amine |
| SMILES | C/N=C1\CC=CCN1NC |
| InChI | InChI=1S/C7H13N3/c1-8-7-5-3-4-6-10(7)9-2/h3-4,9H,5-6H2,1-2H3/b8-7+ |
| InChIKey | QZSXKSCOCJKDTR-BQYQJAHWSA-N |
| XLogP | 0.41 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-6-methylimino-2,5-dihydropyridin-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-6-methylimino-2,5-dihydropyridin-1-amine?
The IUPAC name of N-methyl-6-methylimino-2,5-dihydropyridin-1-amine (CID 57320112) is N-methyl-6-methylimino-2,5-dihydropyridin-1-amine.
What is the SMILES notation for N-methyl-6-methylimino-2,5-dihydropyridin-1-amine?
The canonical SMILES for N-methyl-6-methylimino-2,5-dihydropyridin-1-amine is C/N=C1\CC=CCN1NC.
What is the InChIKey of N-methyl-6-methylimino-2,5-dihydropyridin-1-amine?
The InChIKey is QZSXKSCOCJKDTR-BQYQJAHWSA-N. The full InChI is InChI=1S/C7H13N3/c1-8-7-5-3-4-6-10(7)9-2/h3-4,9H,5-6H2,1-2H3/b8-7+.
What are the key properties of N-methyl-6-methylimino-2,5-dihydropyridin-1-amine?
N-methyl-6-methylimino-2,5-dihydropyridin-1-amine has a molecular weight of 139.20 g/mol, XLogP of 0.41, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-6-methylimino-2,5-dihydropyridin-1-amine is sourced from PubChem (CID 57320112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).