About 6-imino-2,5-dihydropyridine-1,5-diamine
6-imino-2,5-dihydropyridine-1,5-diamine (PubChem CID 91290451) has the molecular formula C5H10N4
and a molecular weight of 126.16 g/mol. Its IUPAC name is 6-imino-2,5-dihydropyridine-1,5-diamine.
Molecular Properties
| Compound Name | 6-imino-2,5-dihydropyridine-1,5-diamine |
| PubChem CID | 91290451 |
| Molecular Formula | C5H10N4 |
| Molecular Weight | 126.16 g/mol |
| Exact Mass | 126.09 |
| IUPAC Name | 6-imino-2,5-dihydropyridine-1,5-diamine |
| SMILES | [H]/N=C1\C(N)C=CCN1N |
| InChI | InChI=1S/C5H10N4/c6-4-2-1-3-9(8)5(4)7/h1-2,4,7H,3,6,8H2/b7-5+ |
| InChIKey | MKCJQFMWFQWQFD-FNORWQNLSA-N |
| XLogP | -0.96 |
| TPSA | 79.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.16 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-imino-2,5-dihydropyridine-1,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-imino-2,5-dihydropyridine-1,5-diamine?
The IUPAC name of 6-imino-2,5-dihydropyridine-1,5-diamine (CID 91290451) is 6-imino-2,5-dihydropyridine-1,5-diamine.
What is the SMILES notation for 6-imino-2,5-dihydropyridine-1,5-diamine?
The canonical SMILES for 6-imino-2,5-dihydropyridine-1,5-diamine is [H]/N=C1\C(N)C=CCN1N.
What is the InChIKey of 6-imino-2,5-dihydropyridine-1,5-diamine?
The InChIKey is MKCJQFMWFQWQFD-FNORWQNLSA-N. The full InChI is InChI=1S/C5H10N4/c6-4-2-1-3-9(8)5(4)7/h1-2,4,7H,3,6,8H2/b7-5+.
What are the key properties of 6-imino-2,5-dihydropyridine-1,5-diamine?
6-imino-2,5-dihydropyridine-1,5-diamine has a molecular weight of 126.16 g/mol, XLogP of -0.96, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-imino-2,5-dihydropyridine-1,5-diamine is sourced from PubChem (CID 91290451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).