C9H16N2 — CID 56625538
N,N-diethyl-2,5-dihydropyridin-6-amine (PubChem CID 56625538) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is N,N-diethyl-2,5-dihydropyridin-6-amine.
| Compound Name | N,N-diethyl-2,5-dihydropyridin-6-amine |
|---|---|
| PubChem CID | 56625538 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | N,N-diethyl-2,5-dihydropyridin-6-amine |
| SMILES | CCN(CC)C1=NCC=CC1 |
| InChI | InChI=1S/C9H16N2/c1-3-11(4-2)9-7-5-6-8-10-9/h5-6H,3-4,7-8H2,1-2H3 |
| InChIKey | HVOVFZLTZHJKGN-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|