C11H23N3 — CID 23272433
(E)-N'-amino-N,N-dipropylpent-3-enimidamide (PubChem CID 23272433) has the molecular formula C11H23N3 and a molecular weight of 197.33 g/mol. Its IUPAC name is (E)-N'-amino-N,N-dipropylpent-3-enimidamide.
| Compound Name | (E)-N'-amino-N,N-dipropylpent-3-enimidamide |
|---|---|
| PubChem CID | 23272433 |
| Molecular Formula | C11H23N3 |
| Molecular Weight | 197.33 g/mol |
| Exact Mass | 197.19 |
| IUPAC Name | (E)-N'-amino-N,N-dipropylpent-3-enimidamide |
| SMILES | C/C=C/C/C(=N/N)N(CCC)CCC |
| InChI | InChI=1S/C11H23N3/c1-4-7-8-11(13-12)14(9-5-2)10-6-3/h4,7H,5-6,8-10,12H2,1-3H3/b7-4+,13-11- |
| InChIKey | YOXODFGWIVDKTC-GWVNSSQISA-N |
| XLogP | 2.35 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.33 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|