C10H21N3 — CID 23272377
N'-amino-N,N-diethyl-4-methylpent-3-enimidamide (PubChem CID 23272377) has the molecular formula C10H21N3 and a molecular weight of 183.30 g/mol. Its IUPAC name is N'-amino-N,N-diethyl-4-methylpent-3-enimidamide.
| Compound Name | N'-amino-N,N-diethyl-4-methylpent-3-enimidamide |
|---|---|
| PubChem CID | 23272377 |
| Molecular Formula | C10H21N3 |
| Molecular Weight | 183.30 g/mol |
| Exact Mass | 183.17 |
| IUPAC Name | N'-amino-N,N-diethyl-4-methylpent-3-enimidamide |
| SMILES | CCN(CC)/C(CC=C(C)C)=N\N |
| InChI | InChI=1S/C10H21N3/c1-5-13(6-2)10(12-11)8-7-9(3)4/h7H,5-6,8,11H2,1-4H3/b12-10- |
| InChIKey | RYWFHJYZNDBSHF-BENRWUELSA-N |
| XLogP | 1.96 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.30 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|