C14H28N2 — CID 12709000
N'-butyl-N,N-diethyl-4-methylpent-3-enimidamide (PubChem CID 12709000) has the molecular formula C14H28N2 and a molecular weight of 224.39 g/mol. Its IUPAC name is N'-butyl-N,N-diethyl-4-methylpent-3-enimidamide.
| Compound Name | N'-butyl-N,N-diethyl-4-methylpent-3-enimidamide |
|---|---|
| PubChem CID | 12709000 |
| Molecular Formula | C14H28N2 |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.23 |
| IUPAC Name | N'-butyl-N,N-diethyl-4-methylpent-3-enimidamide |
| SMILES | CCCC/N=C(\CC=C(C)C)N(CC)CC |
| InChI | InChI=1S/C14H28N2/c1-6-9-12-15-14(11-10-13(4)5)16(7-2)8-3/h10H,6-9,11-12H2,1-5H3/b15-14+ |
| InChIKey | CTYSPAPXIITINY-CCEZHUSRSA-N |
| XLogP | 3.88 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|