C10H18N2 — CID 56629172
N-butyl-1-methyl-2,5-dihydropyridin-6-imine (PubChem CID 56629172) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is N-butyl-1-methyl-2,5-dihydropyridin-6-imine.
| Compound Name | N-butyl-1-methyl-2,5-dihydropyridin-6-imine |
|---|---|
| PubChem CID | 56629172 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | N-butyl-1-methyl-2,5-dihydropyridin-6-imine |
| SMILES | CCCC/N=C1\CC=CCN1C |
| InChI | InChI=1S/C10H18N2/c1-3-4-8-11-10-7-5-6-9-12(10)2/h5-6H,3-4,7-9H2,1-2H3/b11-10+ |
| InChIKey | AJRFFSZFKYQCNU-ZHACJKMWSA-N |
| XLogP | 2.08 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|