C11H20N2 — CID 56627937
N,1-di(propan-2-yl)-2,5-dihydropyridin-6-imine (PubChem CID 56627937) has the molecular formula C11H20N2 and a molecular weight of 180.29 g/mol. Its IUPAC name is N,1-di(propan-2-yl)-2,5-dihydropyridin-6-imine.
| Compound Name | N,1-di(propan-2-yl)-2,5-dihydropyridin-6-imine |
|---|---|
| PubChem CID | 56627937 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | N,1-di(propan-2-yl)-2,5-dihydropyridin-6-imine |
| SMILES | CC(C)/N=C1\CC=CCN1C(C)C |
| InChI | InChI=1S/C11H20N2/c1-9(2)12-11-7-5-6-8-13(11)10(3)4/h5-6,9-10H,7-8H2,1-4H3/b12-11+ |
| InChIKey | GWWHEHMGKLMNAR-VAWYXSNFSA-N |
| XLogP | 2.46 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|