C9H16N2 — CID 56620050
1-methyl-N-propan-2-yl-2,5-dihydropyridin-6-imine (PubChem CID 56620050) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is 1-methyl-N-propan-2-yl-2,5-dihydropyridin-6-imine.
| Compound Name | 1-methyl-N-propan-2-yl-2,5-dihydropyridin-6-imine |
|---|---|
| PubChem CID | 56620050 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | 1-methyl-N-propan-2-yl-2,5-dihydropyridin-6-imine |
| SMILES | CC(C)/N=C1\CC=CCN1C |
| InChI | InChI=1S/C9H16N2/c1-8(2)10-9-6-4-5-7-11(9)3/h4-5,8H,6-7H2,1-3H3/b10-9+ |
| InChIKey | DTPKBXDSTXNGMV-MDZDMXLPSA-N |
| XLogP | 1.68 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|