C8H14N2 — CID 56614380
N-ethyl-1-methyl-2,5-dihydropyridin-6-imine (PubChem CID 56614380) has the molecular formula C8H14N2 and a molecular weight of 138.21 g/mol. Its IUPAC name is N-ethyl-1-methyl-2,5-dihydropyridin-6-imine.
| Compound Name | N-ethyl-1-methyl-2,5-dihydropyridin-6-imine |
|---|---|
| PubChem CID | 56614380 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | N-ethyl-1-methyl-2,5-dihydropyridin-6-imine |
| SMILES | CC/N=C1\CC=CCN1C |
| InChI | InChI=1S/C8H14N2/c1-3-9-8-6-4-5-7-10(8)2/h4-5H,3,6-7H2,1-2H3/b9-8+ |
| InChIKey | OWMTZJRAZOLUSJ-CMDGGOBGSA-N |
| XLogP | 1.30 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|