About N'-(dimethylamino)-N,N-diethyl-4-methylpent-3-enimidamide
N'-(dimethylamino)-N,N-diethyl-4-methylpent-3-enimidamide (PubChem CID 23272502) has the molecular formula C12H25N3
and a molecular weight of 211.35 g/mol. Its IUPAC name is N'-(dimethylamino)-N,N-diethyl-4-methylpent-3-enimidamide.
Molecular Properties
| Compound Name | N'-(dimethylamino)-N,N-diethyl-4-methylpent-3-enimidamide |
| PubChem CID | 23272502 |
| Molecular Formula | C12H25N3 |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.20 |
| IUPAC Name | N'-(dimethylamino)-N,N-diethyl-4-methylpent-3-enimidamide |
| SMILES | CCN(CC)/C(CC=C(C)C)=N\N(C)C |
| InChI | InChI=1S/C12H25N3/c1-7-15(8-2)12(13-14(5)6)10-9-11(3)4/h9H,7-8,10H2,1-6H3/b13-12- |
| InChIKey | URQHMIOPMODYON-SEYXRHQNSA-N |
| XLogP | 2.56 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-(dimethylamino)-N,N-diethyl-4-methylpent-3-enimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(dimethylamino)-N,N-diethyl-4-methylpent-3-enimidamide?
The IUPAC name of N'-(dimethylamino)-N,N-diethyl-4-methylpent-3-enimidamide (CID 23272502) is N'-(dimethylamino)-N,N-diethyl-4-methylpent-3-enimidamide.
What is the SMILES notation for N'-(dimethylamino)-N,N-diethyl-4-methylpent-3-enimidamide?
The canonical SMILES for N'-(dimethylamino)-N,N-diethyl-4-methylpent-3-enimidamide is CCN(CC)/C(CC=C(C)C)=N\N(C)C.
What is the InChIKey of N'-(dimethylamino)-N,N-diethyl-4-methylpent-3-enimidamide?
The InChIKey is URQHMIOPMODYON-SEYXRHQNSA-N. The full InChI is InChI=1S/C12H25N3/c1-7-15(8-2)12(13-14(5)6)10-9-11(3)4/h9H,7-8,10H2,1-6H3/b13-12-.
What are the key properties of N'-(dimethylamino)-N,N-diethyl-4-methylpent-3-enimidamide?
N'-(dimethylamino)-N,N-diethyl-4-methylpent-3-enimidamide has a molecular weight of 211.35 g/mol, XLogP of 2.56, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(dimethylamino)-N,N-diethyl-4-methylpent-3-enimidamide is sourced from PubChem (CID 23272502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).