C13H24N2 — CID 12709002
N,N-diethyl-4-methyl-N'-prop-2-enylpent-3-enimidamide (PubChem CID 12709002) has the molecular formula C13H24N2 and a molecular weight of 208.35 g/mol. Its IUPAC name is N,N-diethyl-4-methyl-N'-prop-2-enylpent-3-enimidamide.
| Compound Name | N,N-diethyl-4-methyl-N'-prop-2-enylpent-3-enimidamide |
|---|---|
| PubChem CID | 12709002 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | N,N-diethyl-4-methyl-N'-prop-2-enylpent-3-enimidamide |
| SMILES | C=CC/N=C(\CC=C(C)C)N(CC)CC |
| InChI | InChI=1S/C13H24N2/c1-6-11-14-13(10-9-12(4)5)15(7-2)8-3/h6,9H,1,7-8,10-11H2,2-5H3/b14-13+ |
| InChIKey | IYYFWMBCVVBTHL-BUHFOSPRSA-N |
| XLogP | 3.27 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|