C9H19N3 — CID 12576986
(E)-N'-amino-N,N-diethylpent-3-enimidamide (PubChem CID 12576986) has the molecular formula C9H19N3 and a molecular weight of 169.27 g/mol. Its IUPAC name is (E)-N'-amino-N,N-diethylpent-3-enimidamide.
| Compound Name | (E)-N'-amino-N,N-diethylpent-3-enimidamide |
|---|---|
| PubChem CID | 12576986 |
| Molecular Formula | C9H19N3 |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.16 |
| IUPAC Name | (E)-N'-amino-N,N-diethylpent-3-enimidamide |
| SMILES | C/C=C/C/C(=N\N)N(CC)CC |
| InChI | InChI=1S/C9H19N3/c1-4-7-8-9(11-10)12(5-2)6-3/h4,7H,5-6,8,10H2,1-3H3/b7-4+,11-9+ |
| InChIKey | FQTLNSTUIKOBCG-WUZDHUPESA-N |
| XLogP | 1.57 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|