About (E)-N'-(dimethylamino)-N,N-diethylpent-3-enimidamide
(E)-N'-(dimethylamino)-N,N-diethylpent-3-enimidamide (PubChem CID 23272434) has the molecular formula C11H23N3
and a molecular weight of 197.33 g/mol. Its IUPAC name is (E)-N'-(dimethylamino)-N,N-diethylpent-3-enimidamide.
Molecular Properties
| Compound Name | (E)-N'-(dimethylamino)-N,N-diethylpent-3-enimidamide |
| PubChem CID | 23272434 |
| Molecular Formula | C11H23N3 |
| Molecular Weight | 197.33 g/mol |
| Exact Mass | 197.19 |
| IUPAC Name | (E)-N'-(dimethylamino)-N,N-diethylpent-3-enimidamide |
| SMILES | C/C=C/C/C(=N\N(C)C)N(CC)CC |
| InChI | InChI=1S/C11H23N3/c1-6-9-10-11(12-13(4)5)14(7-2)8-3/h6,9H,7-8,10H2,1-5H3/b9-6+,12-11+ |
| InChIKey | WLAZFHHGDWNTGP-SQXBUMSNSA-N |
| XLogP | 2.17 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.33 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-N'-(dimethylamino)-N,N-diethylpent-3-enimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N'-(dimethylamino)-N,N-diethylpent-3-enimidamide?
The IUPAC name of (E)-N'-(dimethylamino)-N,N-diethylpent-3-enimidamide (CID 23272434) is (E)-N'-(dimethylamino)-N,N-diethylpent-3-enimidamide.
What is the SMILES notation for (E)-N'-(dimethylamino)-N,N-diethylpent-3-enimidamide?
The canonical SMILES for (E)-N'-(dimethylamino)-N,N-diethylpent-3-enimidamide is C/C=C/C/C(=N\N(C)C)N(CC)CC.
What is the InChIKey of (E)-N'-(dimethylamino)-N,N-diethylpent-3-enimidamide?
The InChIKey is WLAZFHHGDWNTGP-SQXBUMSNSA-N. The full InChI is InChI=1S/C11H23N3/c1-6-9-10-11(12-13(4)5)14(7-2)8-3/h6,9H,7-8,10H2,1-5H3/b9-6+,12-11+.
What are the key properties of (E)-N'-(dimethylamino)-N,N-diethylpent-3-enimidamide?
(E)-N'-(dimethylamino)-N,N-diethylpent-3-enimidamide has a molecular weight of 197.33 g/mol, XLogP of 2.17, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N'-(dimethylamino)-N,N-diethylpent-3-enimidamide is sourced from PubChem (CID 23272434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).