About N-but-3-enyl-N',2-dicyano-N-hept-3-enylethanimidamide
N-but-3-enyl-N',2-dicyano-N-hept-3-enylethanimidamide (PubChem CID 54240278) has the molecular formula C15H22N4
and a molecular weight of 258.37 g/mol. Its IUPAC name is N-but-3-enyl-N',2-dicyano-N-hept-3-enylethanimidamide.
Molecular Properties
| Compound Name | N-but-3-enyl-N',2-dicyano-N-hept-3-enylethanimidamide |
| PubChem CID | 54240278 |
| Molecular Formula | C15H22N4 |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | N-but-3-enyl-N',2-dicyano-N-hept-3-enylethanimidamide |
| SMILES | C=CCCN(CCC=CCCC)/C(CC#N)=N/C#N |
| InChI | InChI=1S/C15H22N4/c1-3-5-7-8-9-13-19(12-6-4-2)15(10-11-16)18-14-17/h4,7-8H,2-3,5-6,9-10,12-13H2,1H3/b8-7?,18-15+ |
| InChIKey | QPNFVQYFGKARNY-RUQNCZIBSA-N |
| XLogP | 3.40 |
| TPSA | 63.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-but-3-enyl-N',2-dicyano-N-hept-3-enylethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-but-3-enyl-N',2-dicyano-N-hept-3-enylethanimidamide?
The IUPAC name of N-but-3-enyl-N',2-dicyano-N-hept-3-enylethanimidamide (CID 54240278) is N-but-3-enyl-N',2-dicyano-N-hept-3-enylethanimidamide.
What is the SMILES notation for N-but-3-enyl-N',2-dicyano-N-hept-3-enylethanimidamide?
The canonical SMILES for N-but-3-enyl-N',2-dicyano-N-hept-3-enylethanimidamide is C=CCCN(CCC=CCCC)/C(CC#N)=N/C#N.
What is the InChIKey of N-but-3-enyl-N',2-dicyano-N-hept-3-enylethanimidamide?
The InChIKey is QPNFVQYFGKARNY-RUQNCZIBSA-N. The full InChI is InChI=1S/C15H22N4/c1-3-5-7-8-9-13-19(12-6-4-2)15(10-11-16)18-14-17/h4,7-8H,2-3,5-6,9-10,12-13H2,1H3/b8-7?,18-15+.
What are the key properties of N-but-3-enyl-N',2-dicyano-N-hept-3-enylethanimidamide?
N-but-3-enyl-N',2-dicyano-N-hept-3-enylethanimidamide has a molecular weight of 258.37 g/mol, XLogP of 3.40, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-but-3-enyl-N',2-dicyano-N-hept-3-enylethanimidamide is sourced from PubChem (CID 54240278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).