C8H12N2 — CID 142811011
5-[(1Z)-buta-1,3-dienyl]-1-methyl-4,5-dihydroimidazole (PubChem CID 142811011) has the molecular formula C8H12N2 and a molecular weight of 136.20 g/mol. Its IUPAC name is 5-[(1Z)-buta-1,3-dienyl]-1-methyl-4,5-dihydroimidazole.
| Compound Name | 5-[(1Z)-buta-1,3-dienyl]-1-methyl-4,5-dihydroimidazole |
|---|---|
| PubChem CID | 142811011 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | 5-[(1Z)-buta-1,3-dienyl]-1-methyl-4,5-dihydroimidazole |
| SMILES | C=C/C=C\C1CN=CN1C |
| InChI | InChI=1S/C8H12N2/c1-3-4-5-8-6-9-7-10(8)2/h3-5,7-8H,1,6H2,2H3/b5-4- |
| InChIKey | XREINPDXVSZTOM-PLNGDYQASA-N |
| XLogP | 1.07 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|