C12H18F2N2 — CID 142933945
N-[(3E,5E,7E)-6,7-difluoronona-3,5,7-trien-2-yl]-N,N'-dimethylmethanimidamide (PubChem CID 142933945) has the molecular formula C12H18F2N2 and a molecular weight of 228.29 g/mol. Its IUPAC name is N-[(3E,5E,7E)-6,7-difluoronona-3,5,7-trien-2-yl]-N,N'-dimethylmethanimidamide.
| Compound Name | N-[(3E,5E,7E)-6,7-difluoronona-3,5,7-trien-2-yl]-N,N'-dimethylmethanimidamide |
|---|---|
| PubChem CID | 142933945 |
| Molecular Formula | C12H18F2N2 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | N-[(3E,5E,7E)-6,7-difluoronona-3,5,7-trien-2-yl]-N,N'-dimethylmethanimidamide |
| SMILES | C/C=C(F)\C(F)=C/C=C/C(C)N(C)/C=N/C |
| InChI | InChI=1S/C12H18F2N2/c1-5-11(13)12(14)8-6-7-10(2)16(4)9-15-3/h5-10H,1-4H3/b7-6+,11-5+,12-8+,15-9+ |
| InChIKey | FFOCEAAQXQFOLU-NDHMMPOWSA-N |
| XLogP | 3.25 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|