C17H26N2 — CID 142177970
N,N'-dimethyl-N-[(3Z,5E,7E,9Z)-7-[(Z)-prop-1-enyl]undeca-3,5,7,9-tetraen-2-yl]methanimidamide (PubChem CID 142177970) has the molecular formula C17H26N2 and a molecular weight of 258.41 g/mol. Its IUPAC name is N,N'-dimethyl-N-[(3Z,5E,7E,9Z)-7-[(Z)-prop-1-enyl]undeca-3,5,7,9-tetraen-2-yl]methanimidamide.
| Compound Name | N,N'-dimethyl-N-[(3Z,5E,7E,9Z)-7-[(Z)-prop-1-enyl]undeca-3,5,7,9-tetraen-2-yl]methanimidamide |
|---|---|
| PubChem CID | 142177970 |
| Molecular Formula | C17H26N2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | N,N'-dimethyl-N-[(3Z,5E,7E,9Z)-7-[(Z)-prop-1-enyl]undeca-3,5,7,9-tetraen-2-yl]methanimidamide |
| SMILES | C/C=C\C=C(/C=C\C)\C=C\C=C/C(C)N(C)/C=N/C |
| InChI | InChI=1S/C17H26N2/c1-6-8-13-17(11-7-2)14-10-9-12-16(3)19(5)15-18-4/h6-16H,1-5H3/b8-6-,11-7-,12-9-,14-10+,17-13+,18-15+ |
| InChIKey | VAZGBVNCCWKHFB-LDXLTYGBSA-N |
| XLogP | 4.16 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|