C21H38N2 — CID 142177969
N,N'-dimethyl-N-[(3Z,5E,7E,9Z)-7-[(Z)-prop-1-enyl]undeca-3,5,7,9-tetraen-2-yl]methanimidamide;ethane (PubChem CID 142177969) has the molecular formula C21H38N2 and a molecular weight of 318.55 g/mol. Its IUPAC name is N,N'-dimethyl-N-[(3Z,5E,7E,9Z)-7-[(Z)-prop-1-enyl]undeca-3,5,7,9-tetraen-2-yl]methanimidamide;ethane.
| Compound Name | N,N'-dimethyl-N-[(3Z,5E,7E,9Z)-7-[(Z)-prop-1-enyl]undeca-3,5,7,9-tetraen-2-yl]methanimidamide;ethane |
|---|---|
| PubChem CID | 142177969 |
| Molecular Formula | C21H38N2 |
| Molecular Weight | 318.55 g/mol |
| Exact Mass | 318.30 |
| IUPAC Name | N,N'-dimethyl-N-[(3Z,5E,7E,9Z)-7-[(Z)-prop-1-enyl]undeca-3,5,7,9-tetraen-2-yl]methanimidamide;ethane |
| SMILES | C/C=C\C=C(/C=C\C)\C=C\C=C/C(C)N(C)/C=N/C.CC.CC |
| InChI | InChI=1S/C17H26N2.2C2H6/c1-6-8-13-17(11-7-2)14-10-9-12-16(3)19(5)15-18-4;2*1-2/h6-16H,1-5H3;2*1-2H3/b8-6-,11-7-,12-9-,14-10+,17-13+,18-15+;; |
| InChIKey | GEMXIWYNMQKAJO-OQCYLFNGSA-N |
| XLogP | 6.21 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.55 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|