C10H18N2 — CID 22898444
N,N-dimethyl-N'-(3-methyl-2-methylidenepent-3-enyl)methanimidamide (PubChem CID 22898444) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is N,N-dimethyl-N'-(3-methyl-2-methylidenepent-3-enyl)methanimidamide.
| Compound Name | N,N-dimethyl-N'-(3-methyl-2-methylidenepent-3-enyl)methanimidamide |
|---|---|
| PubChem CID | 22898444 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | N,N-dimethyl-N'-(3-methyl-2-methylidenepent-3-enyl)methanimidamide |
| SMILES | C=C(C/N=C/N(C)C)C(C)=CC |
| InChI | InChI=1S/C10H18N2/c1-6-9(2)10(3)7-11-8-12(4)5/h6,8H,3,7H2,1-2,4-5H3/b9-6?,11-8+ |
| InChIKey | AEIPFOZIGFVEGA-GWVBEGLUSA-N |
| XLogP | 2.10 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|