About 1-(2-methanidylidene-3-methylpent-3-enyl)imino-N,N-dimethylmethanamine;bis(yttrium)
1-(2-methanidylidene-3-methylpent-3-enyl)imino-N,N-dimethylmethanamine;bis(yttrium) (PubChem CID 59952992) has the molecular formula C10H15N2Y2-3
and a molecular weight of 341.06 g/mol. Its IUPAC name is 1-(2-methanidylidene-3-methylpent-3-enyl)imino-N,N-dimethylmethanamine;bis(yttrium).
Molecular Properties
| Compound Name | 1-(2-methanidylidene-3-methylpent-3-enyl)imino-N,N-dimethylmethanamine;bis(yttrium) |
| PubChem CID | 59952992 |
| Molecular Formula | C10H15N2Y2-3 |
| Molecular Weight | 341.06 g/mol |
| Exact Mass | 340.94 |
| IUPAC Name | 1-(2-methanidylidene-3-methylpent-3-enyl)imino-N,N-dimethylmethanamine;bis(yttrium) |
| SMILES | [CH-]=C(C/N=[C-]/N(C)C)/C(C)=[C-]/C.[Y].[Y] |
| InChI | InChI=1S/C10H15N2.2Y/c1-6-9(2)10(3)7-11-8-12(4)5;;/h3H,7H2,1-2,4-5H3;;/q-3;; |
| InChIKey | SGIJQWJPMZFZAN-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.06 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-methanidylidene-3-methylpent-3-enyl)imino-N,N-dimethylmethanamine;bis(yttrium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-methanidylidene-3-methylpent-3-enyl)imino-N,N-dimethylmethanamine;bis(yttrium)?
The IUPAC name of 1-(2-methanidylidene-3-methylpent-3-enyl)imino-N,N-dimethylmethanamine;bis(yttrium) (CID 59952992) is 1-(2-methanidylidene-3-methylpent-3-enyl)imino-N,N-dimethylmethanamine;bis(yttrium).
What is the SMILES notation for 1-(2-methanidylidene-3-methylpent-3-enyl)imino-N,N-dimethylmethanamine;bis(yttrium)?
The canonical SMILES for 1-(2-methanidylidene-3-methylpent-3-enyl)imino-N,N-dimethylmethanamine;bis(yttrium) is [CH-]=C(C/N=[C-]/N(C)C)/C(C)=[C-]/C.[Y].[Y].
What is the InChIKey of 1-(2-methanidylidene-3-methylpent-3-enyl)imino-N,N-dimethylmethanamine;bis(yttrium)?
The InChIKey is SGIJQWJPMZFZAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N2.2Y/c1-6-9(2)10(3)7-11-8-12(4)5;;/h3H,7H2,1-2,4-5H3;;/q-3;;.
What are the key properties of 1-(2-methanidylidene-3-methylpent-3-enyl)imino-N,N-dimethylmethanamine;bis(yttrium)?
1-(2-methanidylidene-3-methylpent-3-enyl)imino-N,N-dimethylmethanamine;bis(yttrium) has a molecular weight of 341.06 g/mol, XLogP of 1.58, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-methanidylidene-3-methylpent-3-enyl)imino-N,N-dimethylmethanamine;bis(yttrium) is sourced from PubChem (CID 59952992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).