C13H23N3 — CID 140968291
N'-(1,3-diethyl-6-methyl-2H-pyridin-5-yl)-N,N-dimethylmethanimidamide (PubChem CID 140968291) has the molecular formula C13H23N3 and a molecular weight of 221.35 g/mol. Its IUPAC name is N'-(1,3-diethyl-6-methyl-2H-pyridin-5-yl)-N,N-dimethylmethanimidamide.
| Compound Name | N'-(1,3-diethyl-6-methyl-2H-pyridin-5-yl)-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 140968291 |
| Molecular Formula | C13H23N3 |
| Molecular Weight | 221.35 g/mol |
| Exact Mass | 221.19 |
| IUPAC Name | N'-(1,3-diethyl-6-methyl-2H-pyridin-5-yl)-N,N-dimethylmethanimidamide |
| SMILES | CCC1=CC(/N=C/N(C)C)=C(C)N(CC)C1 |
| InChI | InChI=1S/C13H23N3/c1-6-12-8-13(14-10-15(4)5)11(3)16(7-2)9-12/h8,10H,6-7,9H2,1-5H3/b14-10+ |
| InChIKey | KAJDCZRQYIRSEN-GXDHUFHOSA-N |
| XLogP | 2.48 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.35 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|