C12H21N3 — CID 57037934
N'-(1,5-diethyl-2H-pyridin-3-yl)-N,N-dimethylmethanimidamide (PubChem CID 57037934) has the molecular formula C12H21N3 and a molecular weight of 207.32 g/mol. Its IUPAC name is N'-(1,5-diethyl-2H-pyridin-3-yl)-N,N-dimethylmethanimidamide.
| Compound Name | N'-(1,5-diethyl-2H-pyridin-3-yl)-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 57037934 |
| Molecular Formula | C12H21N3 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | N'-(1,5-diethyl-2H-pyridin-3-yl)-N,N-dimethylmethanimidamide |
| SMILES | CCC1=CN(CC)CC(/N=C/N(C)C)=C1 |
| InChI | InChI=1S/C12H21N3/c1-5-11-7-12(13-10-14(3)4)9-15(6-2)8-11/h7-8,10H,5-6,9H2,1-4H3/b13-10+ |
| InChIKey | FZEPWRXNJBEGFA-JLHYYAGUSA-N |
| XLogP | 2.09 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|