C11H19N3 — CID 142175061
N,N,N',1,4-pentamethyl-2H-pyridine-6-carboximidamide (PubChem CID 142175061) has the molecular formula C11H19N3 and a molecular weight of 193.29 g/mol. Its IUPAC name is N,N,N',1,4-pentamethyl-2H-pyridine-6-carboximidamide.
| Compound Name | N,N,N',1,4-pentamethyl-2H-pyridine-6-carboximidamide |
|---|---|
| PubChem CID | 142175061 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | N,N,N',1,4-pentamethyl-2H-pyridine-6-carboximidamide |
| SMILES | C/N=C(/C1=CC(C)=CCN1C)N(C)C |
| InChI | InChI=1S/C11H19N3/c1-9-6-7-14(5)10(8-9)11(12-2)13(3)4/h6,8H,7H2,1-5H3/b12-11- |
| InChIKey | GEFZDIKGFDYYEI-QXMHVHEDSA-N |
| XLogP | 1.35 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|