C22H44N2 — CID 143929987
ethane;ethene;N'-[(2E,4Z)-hepta-2,4-dien-3-yl]-N-methyl-N-(2-methylidenebut-3-enyl)methanimidamide (PubChem CID 143929987) has the molecular formula C22H44N2 and a molecular weight of 336.61 g/mol. Its IUPAC name is ethane;ethene;N'-[(2E,4Z)-hepta-2,4-dien-3-yl]-N-methyl-N-(2-methylidenebut-3-enyl)methanimidamide.
| Compound Name | ethane;ethene;N'-[(2E,4Z)-hepta-2,4-dien-3-yl]-N-methyl-N-(2-methylidenebut-3-enyl)methanimidamide |
|---|---|
| PubChem CID | 143929987 |
| Molecular Formula | C22H44N2 |
| Molecular Weight | 336.61 g/mol |
| Exact Mass | 336.35 |
| IUPAC Name | ethane;ethene;N'-[(2E,4Z)-hepta-2,4-dien-3-yl]-N-methyl-N-(2-methylidenebut-3-enyl)methanimidamide |
| SMILES | C=C.C=CC(=C)CN(C)/C=N/C(/C=C\CC)=C/C.CC.CC.CC |
| InChI | InChI=1S/C14H22N2.3C2H6.C2H4/c1-6-9-10-14(8-3)15-12-16(5)11-13(4)7-2;4*1-2/h7-10,12H,2,4,6,11H2,1,3,5H3;3*1-2H3;1-2H2/b10-9-,14-8+,15-12+;;;; |
| InChIKey | FGOMLANSGAMBBL-YGGGHMSDSA-N |
| XLogP | 7.44 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.61 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|