C10H16N2 — CID 145180329
N,N'-dimethyl-N-[(1E,4Z)-3-methylidenehexa-1,4-dienyl]methanimidamide (PubChem CID 145180329) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is N,N'-dimethyl-N-[(1E,4Z)-3-methylidenehexa-1,4-dienyl]methanimidamide.
| Compound Name | N,N'-dimethyl-N-[(1E,4Z)-3-methylidenehexa-1,4-dienyl]methanimidamide |
|---|---|
| PubChem CID | 145180329 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | N,N'-dimethyl-N-[(1E,4Z)-3-methylidenehexa-1,4-dienyl]methanimidamide |
| SMILES | C=C(/C=C\C)/C=C/N(C)/C=N/C |
| InChI | InChI=1S/C10H16N2/c1-5-6-10(2)7-8-12(4)9-11-3/h5-9H,2H2,1,3-4H3/b6-5-,8-7+,11-9+ |
| InChIKey | IYMWNHRVXYTKKF-GGBISBKUSA-N |
| XLogP | 2.22 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|