C13H18N2 — CID 143839387
N-(5,5-dimethylcyclohepta-1,3,6-trien-1-yl)-N-ethenyl-N'-methylmethanimidamide (PubChem CID 143839387) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is N-(5,5-dimethylcyclohepta-1,3,6-trien-1-yl)-N-ethenyl-N'-methylmethanimidamide.
| Compound Name | N-(5,5-dimethylcyclohepta-1,3,6-trien-1-yl)-N-ethenyl-N'-methylmethanimidamide |
|---|---|
| PubChem CID | 143839387 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | N-(5,5-dimethylcyclohepta-1,3,6-trien-1-yl)-N-ethenyl-N'-methylmethanimidamide |
| SMILES | C=CN(/C=N/C)C1=CC=CC(C)(C)C=C1 |
| InChI | InChI=1S/C13H18N2/c1-5-15(11-14-4)12-7-6-9-13(2,3)10-8-12/h5-11H,1H2,2-4H3/b14-11+ |
| InChIKey | WWSQYYFFDNQBIM-SDNWHVSQSA-N |
| XLogP | 3.13 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|