C12H20N3+ — CID 123841316
ethenyl-methyl-[[methyl-[(3Z)-5-methyliminohexa-1,3-dien-2-yl]amino]methylidene]azanium (PubChem CID 123841316) has the molecular formula C12H20N3+ and a molecular weight of 206.31 g/mol. Its IUPAC name is ethenyl-methyl-[[methyl-[(3Z)-5-methyliminohexa-1,3-dien-2-yl]amino]methylidene]azanium.
| Compound Name | ethenyl-methyl-[[methyl-[(3Z)-5-methyliminohexa-1,3-dien-2-yl]amino]methylidene]azanium |
|---|---|
| PubChem CID | 123841316 |
| Molecular Formula | C12H20N3+ |
| Molecular Weight | 206.31 g/mol |
| Exact Mass | 206.17 |
| IUPAC Name | ethenyl-methyl-[[methyl-[(3Z)-5-methyliminohexa-1,3-dien-2-yl]amino]methylidene]azanium |
| SMILES | C=C/[N+](C)=C/N(C)C(=C)/C=C\C(C)=N\C |
| InChI | InChI=1S/C12H20N3/c1-7-14(5)10-15(6)12(3)9-8-11(2)13-4/h7-10H,1,3H2,2,4-6H3/q+1/b9-8-,13-11+ |
| InChIKey | YDGUYYKYCIRIBL-CWXHDNBGSA-N |
| XLogP | 1.89 |
| TPSA | 18.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.31 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|