C10H17N3 — CID 123604997
N,N-dimethyl-N'-[1-[[(Z)-pent-3-en-2-ylidene]amino]ethenyl]methanimidamide (PubChem CID 123604997) has the molecular formula C10H17N3 and a molecular weight of 179.27 g/mol. Its IUPAC name is N,N-dimethyl-N'-[1-[[(Z)-pent-3-en-2-ylidene]amino]ethenyl]methanimidamide.
| Compound Name | N,N-dimethyl-N'-[1-[[(Z)-pent-3-en-2-ylidene]amino]ethenyl]methanimidamide |
|---|---|
| PubChem CID | 123604997 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | N,N-dimethyl-N'-[1-[[(Z)-pent-3-en-2-ylidene]amino]ethenyl]methanimidamide |
| SMILES | C=C(N=CN(C)C)N=C(C)/C=C\C |
| InChI | InChI=1S/C10H17N3/c1-6-7-9(2)12-10(3)11-8-13(4)5/h6-8H,3H2,1-2,4-5H3/b7-6-,11-8?,12-9? |
| InChIKey | VJHVTDDSEBEJTG-LQOBZPHASA-N |
| XLogP | 2.08 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|