C14H28N2 — CID 145330533
ethane;(2Z)-N'-ethenyl-N,N,4-trimethylpenta-2,4-dienimidamide (PubChem CID 145330533) has the molecular formula C14H28N2 and a molecular weight of 224.39 g/mol. Its IUPAC name is ethane;(2Z)-N'-ethenyl-N,N,4-trimethylpenta-2,4-dienimidamide.
| Compound Name | ethane;(2Z)-N'-ethenyl-N,N,4-trimethylpenta-2,4-dienimidamide |
|---|---|
| PubChem CID | 145330533 |
| Molecular Formula | C14H28N2 |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.23 |
| IUPAC Name | ethane;(2Z)-N'-ethenyl-N,N,4-trimethylpenta-2,4-dienimidamide |
| SMILES | C=C/N=C(/C=C\C(=C)C)N(C)C.CC.CC |
| InChI | InChI=1S/C10H16N2.2C2H6/c1-6-11-10(12(4)5)8-7-9(2)3;2*1-2/h6-8H,1-2H2,3-5H3;2*1-2H3/b8-7-,11-10-;; |
| InChIKey | IAJGUAGYDDROPS-JQBIHOSXSA-N |
| XLogP | 4.27 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|