C9H16N2 — CID 143887769
(2Z,4Z)-N,N,4-trimethyl-5-(methylideneamino)penta-2,4-dien-1-amine (PubChem CID 143887769) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is (2Z,4Z)-N,N,4-trimethyl-5-(methylideneamino)penta-2,4-dien-1-amine.
| Compound Name | (2Z,4Z)-N,N,4-trimethyl-5-(methylideneamino)penta-2,4-dien-1-amine |
|---|---|
| PubChem CID | 143887769 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | (2Z,4Z)-N,N,4-trimethyl-5-(methylideneamino)penta-2,4-dien-1-amine |
| SMILES | C=N/C=C(C)\C=C/CN(C)C |
| InChI | InChI=1S/C9H16N2/c1-9(8-10-2)6-5-7-11(3)4/h5-6,8H,2,7H2,1,3-4H3/b6-5-,9-8- |
| InChIKey | QZLDORLKZUSCTC-AFJQJTPPSA-N |
| XLogP | 1.71 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|