C21H49N3 — CID 169233257
ethane;1-methyl-2-[(3Z)-3-methylhexa-3,5-dienyl]-1-propan-2-ylguanidine;propane (PubChem CID 169233257) has the molecular formula C21H49N3 and a molecular weight of 343.64 g/mol. Its IUPAC name is ethane;1-methyl-2-[(3Z)-3-methylhexa-3,5-dienyl]-1-propan-2-ylguanidine;propane.
| Compound Name | ethane;1-methyl-2-[(3Z)-3-methylhexa-3,5-dienyl]-1-propan-2-ylguanidine;propane |
|---|---|
| PubChem CID | 169233257 |
| Molecular Formula | C21H49N3 |
| Molecular Weight | 343.64 g/mol |
| Exact Mass | 343.39 |
| IUPAC Name | ethane;1-methyl-2-[(3Z)-3-methylhexa-3,5-dienyl]-1-propan-2-ylguanidine;propane |
| SMILES | C=C/C=C(/C)CC/N=C(\N)N(C)C(C)C.CC.CC.CC.CCC |
| InChI | InChI=1S/C12H23N3.C3H8.3C2H6/c1-6-7-11(4)8-9-14-12(13)15(5)10(2)3;1-3-2;3*1-2/h6-7,10H,1,8-9H2,2-5H3,(H2,13,14);3H2,1-2H3;3*1-2H3/b11-7-;;;; |
| InChIKey | OCIRLSAENKNQTL-YIUUKBIWSA-N |
| XLogP | 6.66 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.64 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|