C14H22N2 — CID 143929988
N'-[(2E,4Z)-hepta-2,4-dien-3-yl]-N-methyl-N-(2-methylidenebut-3-enyl)methanimidamide (PubChem CID 143929988) has the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. Its IUPAC name is N'-[(2E,4Z)-hepta-2,4-dien-3-yl]-N-methyl-N-(2-methylidenebut-3-enyl)methanimidamide.
| Compound Name | N'-[(2E,4Z)-hepta-2,4-dien-3-yl]-N-methyl-N-(2-methylidenebut-3-enyl)methanimidamide |
|---|---|
| PubChem CID | 143929988 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | N'-[(2E,4Z)-hepta-2,4-dien-3-yl]-N-methyl-N-(2-methylidenebut-3-enyl)methanimidamide |
| SMILES | C=CC(=C)CN(C)/C=N/C(/C=C\CC)=C/C |
| InChI | InChI=1S/C14H22N2/c1-6-9-10-14(8-3)15-12-16(5)11-13(4)7-2/h7-10,12H,2,4,6,11H2,1,3,5H3/b10-9-,14-8+,15-12+ |
| InChIKey | DTDNUJXGPVUGKB-ANPCEXQDSA-N |
| XLogP | 3.56 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|