C18H26N2 — CID 129163450
(4S,5Z,7Z)-1,4,9-trimethyl-2-[(3E,5Z)-octa-3,5,7-trien-4-yl]-4,9-dihydro-1,3-diazonine (PubChem CID 129163450) has the molecular formula C18H26N2 and a molecular weight of 270.42 g/mol. Its IUPAC name is (4S,5Z,7Z)-1,4,9-trimethyl-2-[(3E,5Z)-octa-3,5,7-trien-4-yl]-4,9-dihydro-1,3-diazonine.
| Compound Name | (4S,5Z,7Z)-1,4,9-trimethyl-2-[(3E,5Z)-octa-3,5,7-trien-4-yl]-4,9-dihydro-1,3-diazonine |
|---|---|
| PubChem CID | 129163450 |
| Molecular Formula | C18H26N2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | (4S,5Z,7Z)-1,4,9-trimethyl-2-[(3E,5Z)-octa-3,5,7-trien-4-yl]-4,9-dihydro-1,3-diazonine |
| SMILES | C=C/C=C\C(=C/CC)\C1=N\[C@@H](C)/C=C\C=C/C(C)N1C |
| InChI | InChI=1S/C18H26N2/c1-6-8-14-17(11-7-2)18-19-15(3)12-9-10-13-16(4)20(18)5/h6,8-16H,1,7H2,2-5H3/b12-9-,13-10-,14-8-,17-11+,19-18-/t15-,16?/m0/s1 |
| InChIKey | WNAIBOIMNYTZBC-VDNQINLDSA-N |
| XLogP | 4.30 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|