C13H19N3 — CID 142229076
(5E)-N,N,2,4-tetramethyl-5-[(2Z)-penta-2,4-dienylidene]-4H-pyrimidin-6-amine (PubChem CID 142229076) has the molecular formula C13H19N3 and a molecular weight of 217.32 g/mol. Its IUPAC name is (5E)-N,N,2,4-tetramethyl-5-[(2Z)-penta-2,4-dienylidene]-4H-pyrimidin-6-amine.
| Compound Name | (5E)-N,N,2,4-tetramethyl-5-[(2Z)-penta-2,4-dienylidene]-4H-pyrimidin-6-amine |
|---|---|
| PubChem CID | 142229076 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | (5E)-N,N,2,4-tetramethyl-5-[(2Z)-penta-2,4-dienylidene]-4H-pyrimidin-6-amine |
| SMILES | C=C/C=C\C=C1\C(N(C)C)=NC(C)=NC1C |
| InChI | InChI=1S/C13H19N3/c1-6-7-8-9-12-10(2)14-11(3)15-13(12)16(4)5/h6-10H,1H2,2-5H3/b8-7-,12-9+ |
| InChIKey | SYDLCAKKCBEGRC-HVTAIUIQSA-N |
| XLogP | 2.44 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|