C13H21N3 — CID 142228891
ethane;N,N,2-trimethyl-8,8a-dihydroquinazolin-4-amine (PubChem CID 142228891) has the molecular formula C13H21N3 and a molecular weight of 219.33 g/mol. Its IUPAC name is ethane;N,N,2-trimethyl-8,8a-dihydroquinazolin-4-amine.
| Compound Name | ethane;N,N,2-trimethyl-8,8a-dihydroquinazolin-4-amine |
|---|---|
| PubChem CID | 142228891 |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | ethane;N,N,2-trimethyl-8,8a-dihydroquinazolin-4-amine |
| SMILES | CC.CC1=NC2CC=CC=C2C(N(C)C)=N1 |
| InChI | InChI=1S/C11H15N3.C2H6/c1-8-12-10-7-5-4-6-9(10)11(13-8)14(2)3;1-2/h4-6,10H,7H2,1-3H3;1-2H3 |
| InChIKey | YZOIIQSNQXJCPD-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |