C16H18 — CID 145498367
9,10-dimethyl-1,2,8,8a-tetrahydroanthracene (PubChem CID 145498367) has the molecular formula C16H18 and a molecular weight of 210.32 g/mol. Its IUPAC name is 9,10-dimethyl-1,2,8,8a-tetrahydroanthracene.
| Compound Name | 9,10-dimethyl-1,2,8,8a-tetrahydroanthracene |
|---|---|
| PubChem CID | 145498367 |
| Molecular Formula | C16H18 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 9,10-dimethyl-1,2,8,8a-tetrahydroanthracene |
| SMILES | CC1=C2C=CCCC2=C(C)C2CC=CC=C12 |
| InChI | InChI=1S/C16H18/c1-11-13-7-3-5-9-15(13)12(2)16-10-6-4-8-14(11)16/h3-5,7-8,15H,6,9-10H2,1-2H3 |
| InChIKey | ITODBBMZMOOYCX-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |