C11H15N3 — CID 91462281
N,N,2-trimethyl-6,8a-dihydroquinazolin-4-amine (PubChem CID 91462281) has the molecular formula C11H15N3 and a molecular weight of 189.26 g/mol. Its IUPAC name is N,N,2-trimethyl-6,8a-dihydroquinazolin-4-amine.
| Compound Name | N,N,2-trimethyl-6,8a-dihydroquinazolin-4-amine |
|---|---|
| PubChem CID | 91462281 |
| Molecular Formula | C11H15N3 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | N,N,2-trimethyl-6,8a-dihydroquinazolin-4-amine |
| SMILES | CC1=NC2C=CCC=C2C(N(C)C)=N1 |
| InChI | InChI=1S/C11H15N3/c1-8-12-10-7-5-4-6-9(10)11(13-8)14(2)3/h5-7,10H,4H2,1-3H3 |
| InChIKey | CHPVBQQRIJIKSZ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|