C10H13N3 — CID 177046902
N,N-dimethyl-6,7-dihydro-1,8-naphthyridin-2-amine (PubChem CID 177046902) has the molecular formula C10H13N3 and a molecular weight of 175.23 g/mol. Its IUPAC name is N,N-dimethyl-6,7-dihydro-1,8-naphthyridin-2-amine.
| Compound Name | N,N-dimethyl-6,7-dihydro-1,8-naphthyridin-2-amine |
|---|---|
| PubChem CID | 177046902 |
| Molecular Formula | C10H13N3 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | N,N-dimethyl-6,7-dihydro-1,8-naphthyridin-2-amine |
| SMILES | CN(C)c1ccc2c(n1)=NCCC=2 |
| InChI | InChI=1S/C10H13N3/c1-13(2)9-6-5-8-4-3-7-11-10(8)12-9/h4-6H,3,7H2,1-2H3 |
| InChIKey | ZMRWMCZCFQUVPS-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 28.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |